Amino Acids – Structure

* Acid Base Indicators
* Acids and Alkali
* Aging and Senescence
* Amino Acids - Feature
* Amino Acids - Structure
* Amniotic Fluid
* Base units (SI)
* Blood Indicators
* Buffer Mixtures
* Cell Animations
* Cell Image Gallery
* Cell Mentor
* Cell Spnapshots
* Cell Video Archives
* Cerebrospinal Fluid
* Enzymes
* Gastric Fluid
* Gene Nomenclature
* Genetic Code
* Greek Alphabet
* Heart EKGs
* Heart Sounds
* Hematologic Indicators
* Human CDs
* Human Non-CDs
* Ideal Weights and Heights
* Journals
* Libraries
* Mouse Primers
* Nomogram
* Pediatric Reference Values
* Periodic Table
* Physiologic Solutions
* Prefixes
* Restriction Enzymes
* Seminal Fluid Indicators
* SI Derived Units
* Species Abbreviations
* Stool Indicators
* Sweat Indicators
* Synovial Fluid Indicators
* Temperature Conversions
* Tris Buffer
* Tumor Atlas
* Urine Indicators
* Weights and Measures
Mol WtpI CAS
Structure formula
ala a
89.09 6.00 56-41-7CH3-CH(NH2)-COOH
arg r
174.2011.15 74-79-3HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH
asn n
132.12 5.41 5794-13-8 H2N-CO-CH2-CH(NH2)-COOH
Aspartic acid
asp d
133.10 2.77 56-84-8 HOOC-CH2-CH(NH2)-COOH
cys c
121.15 5.02 52-90-4 HS-CH2-CH(NH2)-COOH
gln q
146.15 5.65 56-85-9H2N-CO-(CH2)2-CH(NH2)-COOH
Glutamic acid
glu e
147.13 3.22 56-86-0HOOC-(CH2)2-CH(NH2)-COOH
gly g
75.07 5.97 56-40-6NH2-CH2-COOH
his h
155.16 7.47 71-00-1 N=C-NH-C=C-CH2-CH(NH2)-COOH
ile i
131.17 5.94 73-32-5CH3-CH2-CH(CH3)-CH(NH2)-COOH
leu l
131.17 5.98 61-90-5(CH3)2-CH-CH2-CH(NH2)-COOH
lys k
146.19 9.5939665-12-8 H2N-(CH2)4-CH(NH2)-COOH
met m
149.21 5.74 63-68-3 CH3-S-(CH2)2-CH(NH2)-COOH
phe f
165.19 5.48 63-91-2 Ph-CH2-CH(NH2)-COOH
pro p
115.13 6.30 147-85-3 NH-(CH2)3-CH-COOH
ser s
105.09 5.68 56-45-1 HO-CH2-CH(NH2)-COOH
thr t
119.12 5.64 72-19-5 CH3-CH(OH)-CH(NH2)-COOH
trp w
204.23 5.89 73-22-3 Ph-NH-CH-C-CH2-CH(NH2)-COOH
tyr y
181.19 5.66 60-18-4HO-p-Ph-CH2-CH(NH2)-COOH
val v
117.15 5.96 72-18-4CH3-CH(CH2)-CH(NH2)-COOH
Grouping of amino acids based on their charges, hydorphobicity and polarity
  • Non-polar
  • Hydrophobic
  • Negatively charged (acidic amino acids)
  • Polar
  • Hydrophilic
  • No charge (non-acidic amino acids)
  • Polar
  • Hydrophilic
  • Positively charged (basic amino acids; non-acidic amino acids)
  • Polar
  • Hydrophilic

Amino acid


Amino acid


Amino acid


Amino acid


phe f


Aspartic acid
asp d


cys c


his h


met m


Glutamic acid
glu e


asn n


lys k


trp w



gln q


arg r


ile i



thr t



val v



tyr y



leu l



ser s



ala a



gly g



pro p
