Amino Acids – Structure

[raw]

* Acid Base Indicators

* Acids and Alkali

* Aging and Senescence

* Amino Acids – Feature

* Amino Acids – Structure

* Amniotic Fluid

* Base units (SI)

* Blood Indicators

* Buffer Mixtures

* Cell Animations

* Cell Image Gallery

* Cell Mentor

* Cell Spnapshots

* Cell Video Archives

* Cerebrospinal Fluid

* Enzymes
* Gastric Fluid

* Gene Nomenclature

* Genetic Code

* Greek Alphabet

* Heart EKGs

* Heart Sounds

* Hematologic Indicators

* Human CDs

* Human Non-CDs

* Ideal Weights and Heights

* Journals

* Libraries

* Mouse Primers

* Nomogram

* Pediatric Reference Values

* Periodic Table
* Physiologic Solutions

* Prefixes

* Restriction Enzymes

* Seminal Fluid Indicators

* SI Derived Units

* Species Abbreviations

* Stool Indicators

* Sweat Indicators
* Synovial Fluid Indicators

* Temperature Conversions

* Tris Buffer

* Tumor Atlas

* Urine Indicators

* Weights and Measures
Name
Abbreviation
Mol Wt pI CAS
Registry
Number
Structure formula

Alanine
ala a
89.09 6.00 56-41-7 CH3-CH(NH2)-COOH

Arginine
arg r
174.20 11.15 74-79-3 HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH

Asparagine
asn n
132.12 5.41 5794-13-8 H2N-CO-CH2-CH(NH2)-COOH

Aspartic acid
asp d
133.10 2.77 56-84-8 HOOC-CH2-CH(NH2)-COOH

Cysteine
cys c
121.15 5.02 52-90-4 HS-CH2-CH(NH2)-COOH

Glutamine
gln q
146.15 5.65 56-85-9 H2N-CO-(CH2)2-CH(NH2)-COOH

Glutamic acid
glu e
147.13 3.22 56-86-0 HOOC-(CH2)2-CH(NH2)-COOH

Glycine
gly g
75.07 5.97 56-40-6 NH2-CH2-COOH

Histidine
his h
155.16 7.47 71-00-1 N=C-NH-C=C-CH2-CH(NH2)-COOH
|________|
Isoleucine
ile i
131.17 5.94 73-32-5 CH3-CH2-CH(CH3)-CH(NH2)-COOH

Leucine
leu l
131.17 5.98 61-90-5 (CH3)2-CH-CH2-CH(NH2)-COOH

Lysine
lys k
146.19 9.59 39665-12-8 H2N-(CH2)4-CH(NH2)-COOH

Methionine
met m
149.21 5.74 63-68-3 CH3-S-(CH2)2-CH(NH2)-COOH

Phenylalanine
phe f
165.19 5.48 63-91-2 Ph-CH2-CH(NH2)-COOH

Proline
pro p
115.13 6.30 147-85-3 NH-(CH2)3-CH-COOH

|_________|
Serine
ser s
105.09 5.68 56-45-1 HO-CH2-CH(NH2)-COOH
Threonine
thr t
119.12 5.64 72-19-5 CH3-CH(OH)-CH(NH2)-COOH

Tryptophan
trp w
204.23 5.89 73-22-3 Ph-NH-CH-C-CH2-CH(NH2)-COOH

|_______|
Tyrosine
tyr y
181.19 5.66 60-18-4 HO-p-Ph-CH2-CH(NH2)-COOH

Valine
val v
117.15 5.96 72-18-4 CH3-CH(CH2)-CH(NH2)-COOH

Grouping of amino acids based on their charges, hydorphobicity and polarity
























































































  • Non-polar


  • Hydrophobic


  • Negatively charged (acidic amino acids)

  • Polar


  • Hydrophilic


  • No charge (non-acidic amino acids)

  • Polar


  • Hydrophilic


  • Positively charged (basic amino acids; non-acidic amino acids)

  • Polar


  • Hydrophilic


Amino acid


pI


Amino acid


pI


Amino acid


pI


Amino acid


pI


Phenylalanine

phe f


5.48


Aspartic acid

asp d


2.77


Cysteine

cys c


5.02


Histidine

his h


7.47


Methionine

met m


5.74


Glutamic acid

glu e


3.22


Asparagine

asn n


5.41


Lysine

lys k


9.59


Tryptophan

trp w


5.89

   

Glutamine

gln q


5.65


Arginine

arg r


11.15


Isoleucine

ile i


5.94

   

Threonine

thr t


5.64

   

Valine

val v


5.96

   

Tyrosine

tyr y


5.66

   

Leucine

leu l


5.98

   

Serine

ser s


5.68

   

Alanine

ala a


6.00

   

Glycine

gly g


5.97

   

Proline

pro p


6.30

           

[/raw]